C60H50O6SSi6 — CID 169210112
2-[(2,4,4,6,6-pentakis-phenyl-1,3,5,2,4,6-trioxatrisilinan-2-yl)sulfanyl]-2,4,4,6,6-pentakis-phenyl-1,3,5,2,4,6-trioxatrisilinane (PubChem CID 169210112) has the molecular formula C60H50O6SSi6 and a molecular weight of 1067.64 g/mol. Its IUPAC name is 2-[(2,4,4,6,6-pentakis-phenyl-1,3,5,2,4,6-trioxatrisilinan-2-yl)sulfanyl]-2,4,4,6,6-pentakis-phenyl-1,3,5,2,4,6-trioxatrisilinane.
| Compound Name | 2-[(2,4,4,6,6-pentakis-phenyl-1,3,5,2,4,6-trioxatrisilinan-2-yl)sulfanyl]-2,4,4,6,6-pentakis-phenyl-1,3,5,2,4,6-trioxatrisilinane |
|---|---|
| PubChem CID | 169210112 |
| Molecular Formula | C60H50O6SSi6 |
| Molecular Weight | 1067.64 g/mol |
| Exact Mass | 1066.19 |
| IUPAC Name | 2-[(2,4,4,6,6-pentakis-phenyl-1,3,5,2,4,6-trioxatrisilinan-2-yl)sulfanyl]-2,4,4,6,6-pentakis-phenyl-1,3,5,2,4,6-trioxatrisilinane |
| SMILES | c1ccc([Si]2(S[Si]3(c4ccccc4)O[Si](c4ccccc4)(c4ccccc4)O[Si](c4ccccc4)(c4ccccc4)O3)O[Si](c3ccccc3)(c3ccccc3)O[Si](c3ccccc3)(c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C60H50O6SSi6/c1-11-31-51(32-12-1)68(52-33-13-2-14-34-52)61-69(53-35-15-3-16-36-53,54-37-17-4-18-38-54)64-72(63-68,59-47-27-9-28-48-59)67-73(60-49-29-10-30-50-60)65-70(55-39-19-5-20-40-55,56-41-21-6-22-42-56)62-71(66-73,57-43-23-7-24-44-57)58-45-25-8-26-46-58/h1-50H |
| InChIKey | VRJOOIKOBAEJIY-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1067.64 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|