C52H52O10Si8 — CID 23266209
8,8,17,17-tetramethyl-2,2,4,4,12,12,14,14-octakis-phenyl-1,3,5,7,9,11,13,15,16,18-decaoxa-2,4,6,8,10,12,14,17-octasiladispiro[5.3.510.36]octadecane (PubChem CID 23266209) has the molecular formula C52H52O10Si8 and a molecular weight of 1061.67 g/mol. Its IUPAC name is 8,8,17,17-tetramethyl-2,2,4,4,12,12,14,14-octakis-phenyl-1,3,5,7,9,11,13,15,16,18-decaoxa-2,4,6,8,10,12,14,17-octasiladispiro[5.3.510.36]octadecane.
| Compound Name | 8,8,17,17-tetramethyl-2,2,4,4,12,12,14,14-octakis-phenyl-1,3,5,7,9,11,13,15,16,18-decaoxa-2,4,6,8,10,12,14,17-octasiladispiro[5.3.510.36]octadecane |
|---|---|
| PubChem CID | 23266209 |
| Molecular Formula | C52H52O10Si8 |
| Molecular Weight | 1061.67 g/mol |
| Exact Mass | 1060.17 |
| IUPAC Name | 8,8,17,17-tetramethyl-2,2,4,4,12,12,14,14-octakis-phenyl-1,3,5,7,9,11,13,15,16,18-decaoxa-2,4,6,8,10,12,14,17-octasiladispiro[5.3.510.36]octadecane |
| SMILES | C[Si]1(C)O[Si]2(O[Si](C)(C)O[Si]3(O1)O[Si](c1ccccc1)(c1ccccc1)O[Si](c1ccccc1)(c1ccccc1)O3)O[Si](c1ccccc1)(c1ccccc1)O[Si](c1ccccc1)(c1ccccc1)O2 |
| InChI | InChI=1S/C52H52O10Si8/c1-63(2)53-69(59-65(45-29-13-5-14-30-45,46-31-15-6-16-32-46)57-66(60-69,47-33-17-7-18-34-47)48-35-19-8-20-36-48)55-64(3,4)56-70(54-63)61-67(49-37-21-9-22-38-49,50-39-23-10-24-40-50)58-68(62-70,51-41-25-11-26-42-51)52-43-27-12-28-44-52/h5-44H,1-4H3 |
| InChIKey | AQXOJWOJKBNHLZ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1061.67 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|