C20H36O8Si6 — CID 13425887
2,8-dihydroxy-4,4,6,6,10,10,12,12-octamethyl-2,8-diphenyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane (PubChem CID 13425887) has the molecular formula C20H36O8Si6 and a molecular weight of 573.02 g/mol. Its IUPAC name is 2,8-dihydroxy-4,4,6,6,10,10,12,12-octamethyl-2,8-diphenyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane.
| Compound Name | 2,8-dihydroxy-4,4,6,6,10,10,12,12-octamethyl-2,8-diphenyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane |
|---|---|
| PubChem CID | 13425887 |
| Molecular Formula | C20H36O8Si6 |
| Molecular Weight | 573.02 g/mol |
| Exact Mass | 572.10 |
| IUPAC Name | 2,8-dihydroxy-4,4,6,6,10,10,12,12-octamethyl-2,8-diphenyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane |
| SMILES | C[Si]1(C)O[Si](C)(C)O[Si](O)(c2ccccc2)O[Si](C)(C)O[Si](C)(C)O[Si](O)(c2ccccc2)O1 |
| InChI | InChI=1S/C20H36O8Si6/c1-29(2)23-30(3,4)26-34(22,20-17-13-10-14-18-20)28-32(7,8)24-31(5,6)27-33(21,25-29)19-15-11-9-12-16-19/h9-18,21-22H,1-8H3 |
| InChIKey | JLJIRXWQVMLZAI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.02 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|