C12H23NO3Si3 — CID 149454720
N,2,4,4,6,6-hexamethyl-N-phenyl-1,3,5,2,4,6-trioxatrisilinan-2-amine (PubChem CID 149454720) has the molecular formula C12H23NO3Si3 and a molecular weight of 313.58 g/mol. Its IUPAC name is N,2,4,4,6,6-hexamethyl-N-phenyl-1,3,5,2,4,6-trioxatrisilinan-2-amine.
| Compound Name | N,2,4,4,6,6-hexamethyl-N-phenyl-1,3,5,2,4,6-trioxatrisilinan-2-amine |
|---|---|
| PubChem CID | 149454720 |
| Molecular Formula | C12H23NO3Si3 |
| Molecular Weight | 313.58 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | N,2,4,4,6,6-hexamethyl-N-phenyl-1,3,5,2,4,6-trioxatrisilinan-2-amine |
| SMILES | CN(c1ccccc1)[Si]1(C)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C12H23NO3Si3/c1-13(12-10-8-7-9-11-12)19(6)15-17(2,3)14-18(4,5)16-19/h7-11H,1-6H3 |
| InChIKey | YYHZLVSZRJBDAI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.58 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|