C7H21NO3Si3 — CID 140893223
N,N,2,4,4,6,6-heptamethyl-1,3,5,2,4,6-trioxatrisilinan-2-amine (PubChem CID 140893223) has the molecular formula C7H21NO3Si3 and a molecular weight of 251.51 g/mol. Its IUPAC name is N,N,2,4,4,6,6-heptamethyl-1,3,5,2,4,6-trioxatrisilinan-2-amine.
| Compound Name | N,N,2,4,4,6,6-heptamethyl-1,3,5,2,4,6-trioxatrisilinan-2-amine |
|---|---|
| PubChem CID | 140893223 |
| Molecular Formula | C7H21NO3Si3 |
| Molecular Weight | 251.51 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | N,N,2,4,4,6,6-heptamethyl-1,3,5,2,4,6-trioxatrisilinan-2-amine |
| SMILES | CN(C)[Si]1(C)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C7H21NO3Si3/c1-8(2)14(7)10-12(3,4)9-13(5,6)11-14/h1-7H3 |
| InChIKey | LDHLKNHLSRTTLI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.51 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|