C8H25ClO3Si4 — CID 175325355
chloro(dimethyl)silane;2,2,4,4,6,6-hexamethyl-1,3,5,2,4,6-trioxatrisilinane (PubChem CID 175325355) has the molecular formula C8H25ClO3Si4 and a molecular weight of 317.08 g/mol. Its IUPAC name is chloro(dimethyl)silane;2,2,4,4,6,6-hexamethyl-1,3,5,2,4,6-trioxatrisilinane.
| Compound Name | chloro(dimethyl)silane;2,2,4,4,6,6-hexamethyl-1,3,5,2,4,6-trioxatrisilinane |
|---|---|
| PubChem CID | 175325355 |
| Molecular Formula | C8H25ClO3Si4 |
| Molecular Weight | 317.08 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | chloro(dimethyl)silane;2,2,4,4,6,6-hexamethyl-1,3,5,2,4,6-trioxatrisilinane |
| SMILES | C[SiH](C)Cl.C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C6H18O3Si3.C2H7ClSi/c1-10(2)7-11(3,4)9-12(5,6)8-10;1-4(2)3/h1-6H3;4H,1-2H3 |
| InChIKey | BLMPHBTXXCEJQY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.08 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|