About beryllium;chloro(dimethyl)silane;hydride
beryllium;chloro(dimethyl)silane;hydride (PubChem CID 174978498) has the molecular formula C2H9BeClSi
and a molecular weight of 105.64 g/mol. Its IUPAC name is beryllium;chloro(dimethyl)silane;hydride.
Molecular Properties
| Compound Name | beryllium;chloro(dimethyl)silane;hydride |
| PubChem CID | 174978498 |
| Molecular Formula | C2H9BeClSi |
| Molecular Weight | 105.64 g/mol |
| Exact Mass | 105.03 |
| IUPAC Name | beryllium;chloro(dimethyl)silane;hydride |
| SMILES | C[SiH](C)Cl.[Be+2].[H-].[H-] |
| InChI | InChI=1S/C2H7ClSi.Be.2H/c1-4(2)3;;;/h4H,1-2H3;;;/q;+2;2*-1 |
| InChIKey | BIJOLWCCPWPHCY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.64 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze beryllium;chloro(dimethyl)silane;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of beryllium;chloro(dimethyl)silane;hydride?
The IUPAC name of beryllium;chloro(dimethyl)silane;hydride (CID 174978498) is beryllium;chloro(dimethyl)silane;hydride.
What is the SMILES notation for beryllium;chloro(dimethyl)silane;hydride?
The canonical SMILES for beryllium;chloro(dimethyl)silane;hydride is C[SiH](C)Cl.[Be+2].[H-].[H-].
What is the InChIKey of beryllium;chloro(dimethyl)silane;hydride?
The InChIKey is BIJOLWCCPWPHCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7ClSi.Be.2H/c1-4(2)3;;;/h4H,1-2H3;;;/q;+2;2*-1.
What are the key properties of beryllium;chloro(dimethyl)silane;hydride?
beryllium;chloro(dimethyl)silane;hydride has a molecular weight of 105.64 g/mol, XLogP of 1.05, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for beryllium;chloro(dimethyl)silane;hydride is sourced from PubChem (CID 174978498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).