About lithium;hydride;trimethylsilane
lithium;hydride;trimethylsilane (PubChem CID 173154481) has the molecular formula C3H11LiSi
and a molecular weight of 82.15 g/mol. Its IUPAC name is lithium;hydride;trimethylsilane.
Molecular Properties
| Compound Name | lithium;hydride;trimethylsilane |
| PubChem CID | 173154481 |
| Molecular Formula | C3H11LiSi |
| Molecular Weight | 82.15 g/mol |
| Exact Mass | 82.08 |
| IUPAC Name | lithium;hydride;trimethylsilane |
| SMILES | C[SiH](C)C.[H-].[Li+] |
| InChI | InChI=1S/C3H10Si.Li.H/c1-4(2)3;;/h4H,1-3H3;;/q;+1;-1 |
| InChIKey | IDRRLKSRSKGEBC-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 82.15 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze lithium;hydride;trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;trimethylsilane?
The IUPAC name of lithium;hydride;trimethylsilane (CID 173154481) is lithium;hydride;trimethylsilane.
What is the SMILES notation for lithium;hydride;trimethylsilane?
The canonical SMILES for lithium;hydride;trimethylsilane is C[SiH](C)C.[H-].[Li+].
What is the InChIKey of lithium;hydride;trimethylsilane?
The InChIKey is IDRRLKSRSKGEBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10Si.Li.H/c1-4(2)3;;/h4H,1-3H3;;/q;+1;-1.
What are the key properties of lithium;hydride;trimethylsilane?
lithium;hydride;trimethylsilane has a molecular weight of 82.15 g/mol, XLogP of -1.78, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;trimethylsilane is sourced from PubChem (CID 173154481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).