About triethylsilane;trimethylsilane
triethylsilane;trimethylsilane (PubChem CID 159958276) has the molecular formula C9H26Si2
and a molecular weight of 190.48 g/mol. Its IUPAC name is triethylsilane;trimethylsilane.
Molecular Properties
| Compound Name | triethylsilane;trimethylsilane |
| PubChem CID | 159958276 |
| Molecular Formula | C9H26Si2 |
| Molecular Weight | 190.48 g/mol |
| Exact Mass | 190.16 |
| IUPAC Name | triethylsilane;trimethylsilane |
| SMILES | CC[SiH](CC)CC.C[SiH](C)C |
| InChI | InChI=1S/C6H16Si.C3H10Si/c1-4-7(5-2)6-3;1-4(2)3/h7H,4-6H2,1-3H3;4H,1-3H3 |
| InChIKey | OCZLDOMNFCUMLS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethylsilane;trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethylsilane;trimethylsilane?
The IUPAC name of triethylsilane;trimethylsilane (CID 159958276) is triethylsilane;trimethylsilane.
What is the SMILES notation for triethylsilane;trimethylsilane?
The canonical SMILES for triethylsilane;trimethylsilane is CC[SiH](CC)CC.C[SiH](C)C.
What is the InChIKey of triethylsilane;trimethylsilane?
The InChIKey is OCZLDOMNFCUMLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16Si.C3H10Si/c1-4-7(5-2)6-3;1-4(2)3/h7H,4-6H2,1-3H3;4H,1-3H3.
What are the key properties of triethylsilane;trimethylsilane?
triethylsilane;trimethylsilane has a molecular weight of 190.48 g/mol, XLogP of 3.38, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triethylsilane;trimethylsilane is sourced from PubChem (CID 159958276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).