About ethyl-hydroxy-methylsilane;hydron
ethyl-hydroxy-methylsilane;hydron (PubChem CID 174987316) has the molecular formula C3H11OSi+
and a molecular weight of 91.21 g/mol. Its IUPAC name is ethyl-hydroxy-methylsilane;hydron.
Molecular Properties
| Compound Name | ethyl-hydroxy-methylsilane;hydron |
| PubChem CID | 174987316 |
| Molecular Formula | C3H11OSi+ |
| Molecular Weight | 91.21 g/mol |
| Exact Mass | 91.06 |
| IUPAC Name | ethyl-hydroxy-methylsilane;hydron |
| SMILES | CC[SiH](C)O.[H+] |
| InChI | InChI=1S/C3H10OSi/c1-3-5(2)4/h4-5H,3H2,1-2H3/p+1 |
| InChIKey | OTAHFOBRVGSQBN-UHFFFAOYSA-O |
| XLogP | 0.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 91.21 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl-hydroxy-methylsilane;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl-hydroxy-methylsilane;hydron?
The IUPAC name of ethyl-hydroxy-methylsilane;hydron (CID 174987316) is ethyl-hydroxy-methylsilane;hydron.
What is the SMILES notation for ethyl-hydroxy-methylsilane;hydron?
The canonical SMILES for ethyl-hydroxy-methylsilane;hydron is CC[SiH](C)O.[H+].
What is the InChIKey of ethyl-hydroxy-methylsilane;hydron?
The InChIKey is OTAHFOBRVGSQBN-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H10OSi/c1-3-5(2)4/h4-5H,3H2,1-2H3/p+1.
What are the key properties of ethyl-hydroxy-methylsilane;hydron?
ethyl-hydroxy-methylsilane;hydron has a molecular weight of 91.21 g/mol, XLogP of 0.46, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl-hydroxy-methylsilane;hydron is sourced from PubChem (CID 174987316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).