About diethoxy(hydroxy)silane
diethoxy(hydroxy)silane (PubChem CID 101059867) has the molecular formula C4H12O3Si
and a molecular weight of 136.22 g/mol. Its IUPAC name is diethoxy(hydroxy)silane.
Molecular Properties
| Compound Name | diethoxy(hydroxy)silane |
| PubChem CID | 101059867 |
| Molecular Formula | C4H12O3Si |
| Molecular Weight | 136.22 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | diethoxy(hydroxy)silane |
| SMILES | CCO[SiH](O)OCC |
| InChI | InChI=1S/C4H12O3Si/c1-3-6-8(5)7-4-2/h5,8H,3-4H2,1-2H3 |
| InChIKey | LPOJRVTUGTXUBW-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.22 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diethoxy(hydroxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxy(hydroxy)silane?
The IUPAC name of diethoxy(hydroxy)silane (CID 101059867) is diethoxy(hydroxy)silane.
What is the SMILES notation for diethoxy(hydroxy)silane?
The canonical SMILES for diethoxy(hydroxy)silane is CCO[SiH](O)OCC.
What is the InChIKey of diethoxy(hydroxy)silane?
The InChIKey is LPOJRVTUGTXUBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12O3Si/c1-3-6-8(5)7-4-2/h5,8H,3-4H2,1-2H3.
What are the key properties of diethoxy(hydroxy)silane?
diethoxy(hydroxy)silane has a molecular weight of 136.22 g/mol, XLogP of -0.23, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxy(hydroxy)silane is sourced from PubChem (CID 101059867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).