About diethoxy(ethyl)silane;hydrochloride
diethoxy(ethyl)silane;hydrochloride (PubChem CID 172697109) has the molecular formula C6H17ClO2Si
and a molecular weight of 184.74 g/mol. Its IUPAC name is diethoxy(ethyl)silane;hydrochloride.
Molecular Properties
| Compound Name | diethoxy(ethyl)silane;hydrochloride |
| PubChem CID | 172697109 |
| Molecular Formula | C6H17ClO2Si |
| Molecular Weight | 184.74 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | diethoxy(ethyl)silane;hydrochloride |
| SMILES | CCO[SiH](CC)OCC.Cl |
| InChI | InChI=1S/C6H16O2Si.ClH/c1-4-7-9(6-3)8-5-2;/h9H,4-6H2,1-3H3;1H |
| InChIKey | CLTALLAMSIHUAX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.74 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diethoxy(ethyl)silane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxy(ethyl)silane;hydrochloride?
The IUPAC name of diethoxy(ethyl)silane;hydrochloride (CID 172697109) is diethoxy(ethyl)silane;hydrochloride.
What is the SMILES notation for diethoxy(ethyl)silane;hydrochloride?
The canonical SMILES for diethoxy(ethyl)silane;hydrochloride is CCO[SiH](CC)OCC.Cl.
What is the InChIKey of diethoxy(ethyl)silane;hydrochloride?
The InChIKey is CLTALLAMSIHUAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O2Si.ClH/c1-4-7-9(6-3)8-5-2;/h9H,4-6H2,1-3H3;1H.
What are the key properties of diethoxy(ethyl)silane;hydrochloride?
diethoxy(ethyl)silane;hydrochloride has a molecular weight of 184.74 g/mol, XLogP of 1.72, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxy(ethyl)silane;hydrochloride is sourced from PubChem (CID 172697109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).