About ethoxy(disilyl)silane
ethoxy(disilyl)silane (PubChem CID 150994535) has the molecular formula C2H12OSi3
and a molecular weight of 136.38 g/mol. Its IUPAC name is ethoxy(disilyl)silane.
Molecular Properties
| Compound Name | ethoxy(disilyl)silane |
| PubChem CID | 150994535 |
| Molecular Formula | C2H12OSi3 |
| Molecular Weight | 136.38 g/mol |
| Exact Mass | 136.02 |
| IUPAC Name | ethoxy(disilyl)silane |
| SMILES | CCO[SiH]([SiH3])[SiH3] |
| InChI | InChI=1S/C2H12OSi3/c1-2-3-6(4)5/h6H,2H2,1,4-5H3 |
| InChIKey | LSUSFSHCLASXRS-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.38 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethoxy(disilyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxy(disilyl)silane?
The IUPAC name of ethoxy(disilyl)silane (CID 150994535) is ethoxy(disilyl)silane.
What is the SMILES notation for ethoxy(disilyl)silane?
The canonical SMILES for ethoxy(disilyl)silane is CCO[SiH]([SiH3])[SiH3].
What is the InChIKey of ethoxy(disilyl)silane?
The InChIKey is LSUSFSHCLASXRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H12OSi3/c1-2-3-6(4)5/h6H,2H2,1,4-5H3.
What are the key properties of ethoxy(disilyl)silane?
ethoxy(disilyl)silane has a molecular weight of 136.38 g/mol, XLogP of -2.53, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxy(disilyl)silane is sourced from PubChem (CID 150994535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).