About diethoxy(methyl)silane;ethanethiol
diethoxy(methyl)silane;ethanethiol (PubChem CID 174413164) has the molecular formula C7H20O2SSi
and a molecular weight of 196.39 g/mol. Its IUPAC name is diethoxy(methyl)silane;ethanethiol.
Molecular Properties
| Compound Name | diethoxy(methyl)silane;ethanethiol |
| PubChem CID | 174413164 |
| Molecular Formula | C7H20O2SSi |
| Molecular Weight | 196.39 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | diethoxy(methyl)silane;ethanethiol |
| SMILES | CCO[SiH](C)OCC.CCS |
| InChI | InChI=1S/C5H14O2Si.C2H6S/c1-4-6-8(3)7-5-2;1-2-3/h8H,4-5H2,1-3H3;3H,2H2,1H3 |
| InChIKey | UUURAHWJRPQMDQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze diethoxy(methyl)silane;ethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxy(methyl)silane;ethanethiol?
The IUPAC name of diethoxy(methyl)silane;ethanethiol (CID 174413164) is diethoxy(methyl)silane;ethanethiol.
What is the SMILES notation for diethoxy(methyl)silane;ethanethiol?
The canonical SMILES for diethoxy(methyl)silane;ethanethiol is CCO[SiH](C)OCC.CCS.
What is the InChIKey of diethoxy(methyl)silane;ethanethiol?
The InChIKey is UUURAHWJRPQMDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14O2Si.C2H6S/c1-4-6-8(3)7-5-2;1-2-3/h8H,4-5H2,1-3H3;3H,2H2,1H3.
What are the key properties of diethoxy(methyl)silane;ethanethiol?
diethoxy(methyl)silane;ethanethiol has a molecular weight of 196.39 g/mol, XLogP of 1.85, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxy(methyl)silane;ethanethiol is sourced from PubChem (CID 174413164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).