C13H36N2O5Si2 — CID 173193103
diethoxy(methyl)silane;2-(trimethoxysilylmethyl)butane-1,4-diamine (PubChem CID 173193103) has the molecular formula C13H36N2O5Si2 and a molecular weight of 356.61 g/mol. Its IUPAC name is diethoxy(methyl)silane;2-(trimethoxysilylmethyl)butane-1,4-diamine.
| Compound Name | diethoxy(methyl)silane;2-(trimethoxysilylmethyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 173193103 |
| Molecular Formula | C13H36N2O5Si2 |
| Molecular Weight | 356.61 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | diethoxy(methyl)silane;2-(trimethoxysilylmethyl)butane-1,4-diamine |
| SMILES | CCO[SiH](C)OCC.CO[Si](CC(CN)CCN)(OC)OC |
| InChI | InChI=1S/C8H22N2O3Si.C5H14O2Si/c1-11-14(12-2,13-3)7-8(6-10)4-5-9;1-4-6-8(3)7-5-2/h8H,4-7,9-10H2,1-3H3;8H,4-5H2,1-3H3 |
| InChIKey | QCHOUFVJHBWSAY-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.61 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|