About 3-triethoxysilylpropan-1-amine;3-trimethoxysilylpropan-1-amine
3-triethoxysilylpropan-1-amine;3-trimethoxysilylpropan-1-amine (PubChem CID 22218761) has the molecular formula C15H40N2O6Si2
and a molecular weight of 400.67 g/mol. Its IUPAC name is 3-triethoxysilylpropan-1-amine;3-trimethoxysilylpropan-1-amine.
Molecular Properties
| Compound Name | 3-triethoxysilylpropan-1-amine;3-trimethoxysilylpropan-1-amine |
| PubChem CID | 22218761 |
| Molecular Formula | C15H40N2O6Si2 |
| Molecular Weight | 400.67 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 3-triethoxysilylpropan-1-amine;3-trimethoxysilylpropan-1-amine |
| SMILES | CCO[Si](CCCN)(OCC)OCC.CO[Si](CCCN)(OC)OC |
| InChI | InChI=1S/C9H23NO3Si.C6H17NO3Si/c1-4-11-14(12-5-2,13-6-3)9-7-8-10;1-8-11(9-2,10-3)6-4-5-7/h4-10H2,1-3H3;4-7H2,1-3H3 |
| InChIKey | NPJQAOLQNZOWHI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.67 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-triethoxysilylpropan-1-amine;3-trimethoxysilylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-triethoxysilylpropan-1-amine;3-trimethoxysilylpropan-1-amine?
The IUPAC name of 3-triethoxysilylpropan-1-amine;3-trimethoxysilylpropan-1-amine (CID 22218761) is 3-triethoxysilylpropan-1-amine;3-trimethoxysilylpropan-1-amine.
What is the SMILES notation for 3-triethoxysilylpropan-1-amine;3-trimethoxysilylpropan-1-amine?
The canonical SMILES for 3-triethoxysilylpropan-1-amine;3-trimethoxysilylpropan-1-amine is CCO[Si](CCCN)(OCC)OCC.CO[Si](CCCN)(OC)OC.
What is the InChIKey of 3-triethoxysilylpropan-1-amine;3-trimethoxysilylpropan-1-amine?
The InChIKey is NPJQAOLQNZOWHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H23NO3Si.C6H17NO3Si/c1-4-11-14(12-5-2,13-6-3)9-7-8-10;1-8-11(9-2,10-3)6-4-5-7/h4-10H2,1-3H3;4-7H2,1-3H3.
What are the key properties of 3-triethoxysilylpropan-1-amine;3-trimethoxysilylpropan-1-amine?
3-triethoxysilylpropan-1-amine;3-trimethoxysilylpropan-1-amine has a molecular weight of 400.67 g/mol, XLogP of 1.60, 15 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-triethoxysilylpropan-1-amine;3-trimethoxysilylpropan-1-amine is sourced from PubChem (CID 22218761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).