About ethoxy(dimethyl)silane;hydrate
ethoxy(dimethyl)silane;hydrate (PubChem CID 161056317) has the molecular formula C4H14O2Si
and a molecular weight of 122.24 g/mol. Its IUPAC name is ethoxy(dimethyl)silane;hydrate.
Molecular Properties
| Compound Name | ethoxy(dimethyl)silane;hydrate |
| PubChem CID | 161056317 |
| Molecular Formula | C4H14O2Si |
| Molecular Weight | 122.24 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | ethoxy(dimethyl)silane;hydrate |
| SMILES | CCO[SiH](C)C.O |
| InChI | InChI=1S/C4H12OSi.H2O/c1-4-5-6(2)3;/h6H,4H2,1-3H3;1H2 |
| InChIKey | VKOZYFXYMMOVIK-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 40.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.24 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethoxy(dimethyl)silane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxy(dimethyl)silane;hydrate?
The IUPAC name of ethoxy(dimethyl)silane;hydrate (CID 161056317) is ethoxy(dimethyl)silane;hydrate.
What is the SMILES notation for ethoxy(dimethyl)silane;hydrate?
The canonical SMILES for ethoxy(dimethyl)silane;hydrate is CCO[SiH](C)C.O.
What is the InChIKey of ethoxy(dimethyl)silane;hydrate?
The InChIKey is VKOZYFXYMMOVIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12OSi.H2O/c1-4-5-6(2)3;/h6H,4H2,1-3H3;1H2.
What are the key properties of ethoxy(dimethyl)silane;hydrate?
ethoxy(dimethyl)silane;hydrate has a molecular weight of 122.24 g/mol, XLogP of 0.18, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxy(dimethyl)silane;hydrate is sourced from PubChem (CID 161056317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).