About ethoxy(dimethyl)silane;3-methoxyprop-1-ene
ethoxy(dimethyl)silane;3-methoxyprop-1-ene (PubChem CID 175122432) has the molecular formula C8H20O2Si
and a molecular weight of 176.33 g/mol. Its IUPAC name is ethoxy(dimethyl)silane;3-methoxyprop-1-ene.
Molecular Properties
| Compound Name | ethoxy(dimethyl)silane;3-methoxyprop-1-ene |
| PubChem CID | 175122432 |
| Molecular Formula | C8H20O2Si |
| Molecular Weight | 176.33 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | ethoxy(dimethyl)silane;3-methoxyprop-1-ene |
| SMILES | C=CCOC.CCO[SiH](C)C |
| InChI | InChI=1S/C4H12OSi.C4H8O/c1-4-5-6(2)3;1-3-4-5-2/h6H,4H2,1-3H3;3H,1,4H2,2H3 |
| InChIKey | CXNHAGCKROHQQV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethoxy(dimethyl)silane;3-methoxyprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxy(dimethyl)silane;3-methoxyprop-1-ene?
The IUPAC name of ethoxy(dimethyl)silane;3-methoxyprop-1-ene (CID 175122432) is ethoxy(dimethyl)silane;3-methoxyprop-1-ene.
What is the SMILES notation for ethoxy(dimethyl)silane;3-methoxyprop-1-ene?
The canonical SMILES for ethoxy(dimethyl)silane;3-methoxyprop-1-ene is C=CCOC.CCO[SiH](C)C.
What is the InChIKey of ethoxy(dimethyl)silane;3-methoxyprop-1-ene?
The InChIKey is CXNHAGCKROHQQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12OSi.C4H8O/c1-4-5-6(2)3;1-3-4-5-2/h6H,4H2,1-3H3;3H,1,4H2,2H3.
What are the key properties of ethoxy(dimethyl)silane;3-methoxyprop-1-ene?
ethoxy(dimethyl)silane;3-methoxyprop-1-ene has a molecular weight of 176.33 g/mol, XLogP of 1.83, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxy(dimethyl)silane;3-methoxyprop-1-ene is sourced from PubChem (CID 175122432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).