About decanedioic acid;3-methoxyprop-1-ene
decanedioic acid;3-methoxyprop-1-ene (PubChem CID 175934270) has the molecular formula C14H26O5
and a molecular weight of 274.36 g/mol. Its IUPAC name is decanedioic acid;3-methoxyprop-1-ene.
Molecular Properties
| Compound Name | decanedioic acid;3-methoxyprop-1-ene |
| PubChem CID | 175934270 |
| Molecular Formula | C14H26O5 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | decanedioic acid;3-methoxyprop-1-ene |
| SMILES | C=CCOC.O=C(O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C10H18O4.C4H8O/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;1-3-4-5-2/h1-8H2,(H,11,12)(H,13,14);3H,1,4H2,2H3 |
| InChIKey | KMJGWGPYVHKTEK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze decanedioic acid;3-methoxyprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decanedioic acid;3-methoxyprop-1-ene?
The IUPAC name of decanedioic acid;3-methoxyprop-1-ene (CID 175934270) is decanedioic acid;3-methoxyprop-1-ene.
What is the SMILES notation for decanedioic acid;3-methoxyprop-1-ene?
The canonical SMILES for decanedioic acid;3-methoxyprop-1-ene is C=CCOC.O=C(O)CCCCCCCCC(=O)O.
What is the InChIKey of decanedioic acid;3-methoxyprop-1-ene?
The InChIKey is KMJGWGPYVHKTEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4.C4H8O/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;1-3-4-5-2/h1-8H2,(H,11,12)(H,13,14);3H,1,4H2,2H3.
What are the key properties of decanedioic acid;3-methoxyprop-1-ene?
decanedioic acid;3-methoxyprop-1-ene has a molecular weight of 274.36 g/mol, XLogP of 3.10, 11 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for decanedioic acid;3-methoxyprop-1-ene is sourced from PubChem (CID 175934270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).