About diethoxy(ethyl)silane;3-[ethoxy(diethyl)silyl]propan-1-amine
diethoxy(ethyl)silane;3-[ethoxy(diethyl)silyl]propan-1-amine (PubChem CID 174054951) has the molecular formula C15H39NO3Si2
and a molecular weight of 337.65 g/mol. Its IUPAC name is diethoxy(ethyl)silane;3-[ethoxy(diethyl)silyl]propan-1-amine.
Molecular Properties
| Compound Name | diethoxy(ethyl)silane;3-[ethoxy(diethyl)silyl]propan-1-amine |
| PubChem CID | 174054951 |
| Molecular Formula | C15H39NO3Si2 |
| Molecular Weight | 337.65 g/mol |
| Exact Mass | 337.25 |
| IUPAC Name | diethoxy(ethyl)silane;3-[ethoxy(diethyl)silyl]propan-1-amine |
| SMILES | CCO[SiH](CC)OCC.CCO[Si](CC)(CC)CCCN |
| InChI | InChI=1S/C9H23NOSi.C6H16O2Si/c1-4-11-12(5-2,6-3)9-7-8-10;1-4-7-9(6-3)8-5-2/h4-10H2,1-3H3;9H,4-6H2,1-3H3 |
| InChIKey | UNRSFWDCCPSPRJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.65 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diethoxy(ethyl)silane;3-[ethoxy(diethyl)silyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxy(ethyl)silane;3-[ethoxy(diethyl)silyl]propan-1-amine?
The IUPAC name of diethoxy(ethyl)silane;3-[ethoxy(diethyl)silyl]propan-1-amine (CID 174054951) is diethoxy(ethyl)silane;3-[ethoxy(diethyl)silyl]propan-1-amine.
What is the SMILES notation for diethoxy(ethyl)silane;3-[ethoxy(diethyl)silyl]propan-1-amine?
The canonical SMILES for diethoxy(ethyl)silane;3-[ethoxy(diethyl)silyl]propan-1-amine is CCO[SiH](CC)OCC.CCO[Si](CC)(CC)CCCN.
What is the InChIKey of diethoxy(ethyl)silane;3-[ethoxy(diethyl)silyl]propan-1-amine?
The InChIKey is UNRSFWDCCPSPRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H23NOSi.C6H16O2Si/c1-4-11-12(5-2,6-3)9-7-8-10;1-4-7-9(6-3)8-5-2/h4-10H2,1-3H3;9H,4-6H2,1-3H3.
What are the key properties of diethoxy(ethyl)silane;3-[ethoxy(diethyl)silyl]propan-1-amine?
diethoxy(ethyl)silane;3-[ethoxy(diethyl)silyl]propan-1-amine has a molecular weight of 337.65 g/mol, XLogP of 3.66, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxy(ethyl)silane;3-[ethoxy(diethyl)silyl]propan-1-amine is sourced from PubChem (CID 174054951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).