About ethyl(dimethyl)silane;methanamine
ethyl(dimethyl)silane;methanamine (PubChem CID 175273362) has the molecular formula C5H17NSi
and a molecular weight of 119.28 g/mol. Its IUPAC name is ethyl(dimethyl)silane;methanamine.
Molecular Properties
| Compound Name | ethyl(dimethyl)silane;methanamine |
| PubChem CID | 175273362 |
| Molecular Formula | C5H17NSi |
| Molecular Weight | 119.28 g/mol |
| Exact Mass | 119.11 |
| IUPAC Name | ethyl(dimethyl)silane;methanamine |
| SMILES | CC[SiH](C)C.CN |
| InChI | InChI=1S/C4H12Si.CH5N/c1-4-5(2)3;1-2/h5H,4H2,1-3H3;2H2,1H3 |
| InChIKey | WEBPHYOQDWOYCP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl(dimethyl)silane;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl(dimethyl)silane;methanamine?
The IUPAC name of ethyl(dimethyl)silane;methanamine (CID 175273362) is ethyl(dimethyl)silane;methanamine.
What is the SMILES notation for ethyl(dimethyl)silane;methanamine?
The canonical SMILES for ethyl(dimethyl)silane;methanamine is CC[SiH](C)C.CN.
What is the InChIKey of ethyl(dimethyl)silane;methanamine?
The InChIKey is WEBPHYOQDWOYCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12Si.CH5N/c1-4-5(2)3;1-2/h5H,4H2,1-3H3;2H2,1H3.
What are the key properties of ethyl(dimethyl)silane;methanamine?
ethyl(dimethyl)silane;methanamine has a molecular weight of 119.28 g/mol, XLogP of 1.07, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl(dimethyl)silane;methanamine is sourced from PubChem (CID 175273362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).