About N,N-dimethylformamide;ethyl(dimethyl)silane
N,N-dimethylformamide;ethyl(dimethyl)silane (PubChem CID 174953021) has the molecular formula C7H19NOSi
and a molecular weight of 161.32 g/mol. Its IUPAC name is N,N-dimethylformamide;ethyl(dimethyl)silane.
Molecular Properties
| Compound Name | N,N-dimethylformamide;ethyl(dimethyl)silane |
| PubChem CID | 174953021 |
| Molecular Formula | C7H19NOSi |
| Molecular Weight | 161.32 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | N,N-dimethylformamide;ethyl(dimethyl)silane |
| SMILES | CC[SiH](C)C.CN(C)C=O |
| InChI | InChI=1S/C4H12Si.C3H7NO/c1-4-5(2)3;1-4(2)3-5/h5H,4H2,1-3H3;3H,1-2H3 |
| InChIKey | WGTWSOCMGVLCDK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylformamide;ethyl(dimethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylformamide;ethyl(dimethyl)silane?
The IUPAC name of N,N-dimethylformamide;ethyl(dimethyl)silane (CID 174953021) is N,N-dimethylformamide;ethyl(dimethyl)silane.
What is the SMILES notation for N,N-dimethylformamide;ethyl(dimethyl)silane?
The canonical SMILES for N,N-dimethylformamide;ethyl(dimethyl)silane is CC[SiH](C)C.CN(C)C=O.
What is the InChIKey of N,N-dimethylformamide;ethyl(dimethyl)silane?
The InChIKey is WGTWSOCMGVLCDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12Si.C3H7NO/c1-4-5(2)3;1-4(2)3-5/h5H,4H2,1-3H3;3H,1-2H3.
What are the key properties of N,N-dimethylformamide;ethyl(dimethyl)silane?
N,N-dimethylformamide;ethyl(dimethyl)silane has a molecular weight of 161.32 g/mol, XLogP of 1.20, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylformamide;ethyl(dimethyl)silane is sourced from PubChem (CID 174953021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).