About N,N-dimethylformamide;oxonickel
N,N-dimethylformamide;oxonickel (PubChem CID 175038088) has the molecular formula C3H7NNiO2
and a molecular weight of 147.79 g/mol. Its IUPAC name is N,N-dimethylformamide;oxonickel.
Molecular Properties
| Compound Name | N,N-dimethylformamide;oxonickel |
| PubChem CID | 175038088 |
| Molecular Formula | C3H7NNiO2 |
| Molecular Weight | 147.79 g/mol |
| Exact Mass | 146.98 |
| IUPAC Name | N,N-dimethylformamide;oxonickel |
| SMILES | CN(C)C=O.O=[Ni] |
| InChI | InChI=1S/C3H7NO.Ni.O/c1-4(2)3-5;;/h3H,1-2H3;; |
| InChIKey | RJHMTLOGWJZWPL-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.79 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylformamide;oxonickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylformamide;oxonickel?
The IUPAC name of N,N-dimethylformamide;oxonickel (CID 175038088) is N,N-dimethylformamide;oxonickel.
What is the SMILES notation for N,N-dimethylformamide;oxonickel?
The canonical SMILES for N,N-dimethylformamide;oxonickel is CN(C)C=O.O=[Ni].
What is the InChIKey of N,N-dimethylformamide;oxonickel?
The InChIKey is RJHMTLOGWJZWPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.Ni.O/c1-4(2)3-5;;/h3H,1-2H3;;.
What are the key properties of N,N-dimethylformamide;oxonickel?
N,N-dimethylformamide;oxonickel has a molecular weight of 147.79 g/mol, XLogP of -0.42, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylformamide;oxonickel is sourced from PubChem (CID 175038088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).