About N,N-dimethylformamide;sulfur monoxide
N,N-dimethylformamide;sulfur monoxide (PubChem CID 87147971) has the molecular formula C3H7NO2S
and a molecular weight of 121.16 g/mol. Its IUPAC name is N,N-dimethylformamide;sulfur monoxide.
Molecular Properties
| Compound Name | N,N-dimethylformamide;sulfur monoxide |
| PubChem CID | 87147971 |
| Molecular Formula | C3H7NO2S |
| Molecular Weight | 121.16 g/mol |
| Exact Mass | 121.02 |
| IUPAC Name | N,N-dimethylformamide;sulfur monoxide |
| SMILES | CN(C)C=O.O=S |
| InChI | InChI=1S/C3H7NO.OS/c1-4(2)3-5;1-2/h3H,1-2H3; |
| InChIKey | DFIKMMCGMGRCPJ-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.16 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylformamide;sulfur monoxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylformamide;sulfur monoxide?
The IUPAC name of N,N-dimethylformamide;sulfur monoxide (CID 87147971) is N,N-dimethylformamide;sulfur monoxide.
What is the SMILES notation for N,N-dimethylformamide;sulfur monoxide?
The canonical SMILES for N,N-dimethylformamide;sulfur monoxide is CN(C)C=O.O=S.
What is the InChIKey of N,N-dimethylformamide;sulfur monoxide?
The InChIKey is DFIKMMCGMGRCPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.OS/c1-4(2)3-5;1-2/h3H,1-2H3;.
What are the key properties of N,N-dimethylformamide;sulfur monoxide?
N,N-dimethylformamide;sulfur monoxide has a molecular weight of 121.16 g/mol, XLogP of -0.63, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylformamide;sulfur monoxide is sourced from PubChem (CID 87147971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).