About azanium;N,N-dimethylformamide;chloride
azanium;N,N-dimethylformamide;chloride (PubChem CID 159495814) has the molecular formula C3H11ClN2O
and a molecular weight of 126.59 g/mol. Its IUPAC name is azanium;N,N-dimethylformamide;chloride.
Molecular Properties
| Compound Name | azanium;N,N-dimethylformamide;chloride |
| PubChem CID | 159495814 |
| Molecular Formula | C3H11ClN2O |
| Molecular Weight | 126.59 g/mol |
| Exact Mass | 126.06 |
| IUPAC Name | azanium;N,N-dimethylformamide;chloride |
| SMILES | CN(C)C=O.[Cl-].[NH4+] |
| InChI | InChI=1S/C3H7NO.ClH.H3N/c1-4(2)3-5;;/h3H,1-2H3;1H;1H3 |
| InChIKey | LYTOHQRGGGEVMQ-UHFFFAOYSA-N |
| XLogP | -2.92 |
| TPSA | 56.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.59 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze azanium;N,N-dimethylformamide;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;N,N-dimethylformamide;chloride?
The IUPAC name of azanium;N,N-dimethylformamide;chloride (CID 159495814) is azanium;N,N-dimethylformamide;chloride.
What is the SMILES notation for azanium;N,N-dimethylformamide;chloride?
The canonical SMILES for azanium;N,N-dimethylformamide;chloride is CN(C)C=O.[Cl-].[NH4+].
What is the InChIKey of azanium;N,N-dimethylformamide;chloride?
The InChIKey is LYTOHQRGGGEVMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.ClH.H3N/c1-4(2)3-5;;/h3H,1-2H3;1H;1H3.
What are the key properties of azanium;N,N-dimethylformamide;chloride?
azanium;N,N-dimethylformamide;chloride has a molecular weight of 126.59 g/mol, XLogP of -2.92, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;N,N-dimethylformamide;chloride is sourced from PubChem (CID 159495814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).