About potassium;butyl-hydroxy-methylsilane;hydride
potassium;butyl-hydroxy-methylsilane;hydride (PubChem CID 174863171) has the molecular formula C5H15KOSi
and a molecular weight of 158.36 g/mol. Its IUPAC name is potassium;butyl-hydroxy-methylsilane;hydride.
Molecular Properties
| Compound Name | potassium;butyl-hydroxy-methylsilane;hydride |
| PubChem CID | 174863171 |
| Molecular Formula | C5H15KOSi |
| Molecular Weight | 158.36 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | potassium;butyl-hydroxy-methylsilane;hydride |
| SMILES | CCCC[SiH](C)O.[H-].[K+] |
| InChI | InChI=1S/C5H14OSi.K.H/c1-3-4-5-7(2)6;;/h6-7H,3-5H2,1-2H3;;/q;+1;-1 |
| InChIKey | NIEOOIBMXYOPMA-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.36 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze potassium;butyl-hydroxy-methylsilane;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;butyl-hydroxy-methylsilane;hydride?
The IUPAC name of potassium;butyl-hydroxy-methylsilane;hydride (CID 174863171) is potassium;butyl-hydroxy-methylsilane;hydride.
What is the SMILES notation for potassium;butyl-hydroxy-methylsilane;hydride?
The canonical SMILES for potassium;butyl-hydroxy-methylsilane;hydride is CCCC[SiH](C)O.[H-].[K+].
What is the InChIKey of potassium;butyl-hydroxy-methylsilane;hydride?
The InChIKey is NIEOOIBMXYOPMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14OSi.K.H/c1-3-4-5-7(2)6;;/h6-7H,3-5H2,1-2H3;;/q;+1;-1.
What are the key properties of potassium;butyl-hydroxy-methylsilane;hydride?
potassium;butyl-hydroxy-methylsilane;hydride has a molecular weight of 158.36 g/mol, XLogP of -1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;butyl-hydroxy-methylsilane;hydride is sourced from PubChem (CID 174863171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).