About butyl(dimethyl)silane;hydrobromide
butyl(dimethyl)silane;hydrobromide (PubChem CID 172772442) has the molecular formula C6H17BrSi
and a molecular weight of 197.19 g/mol. Its IUPAC name is butyl(dimethyl)silane;hydrobromide.
Molecular Properties
| Compound Name | butyl(dimethyl)silane;hydrobromide |
| PubChem CID | 172772442 |
| Molecular Formula | C6H17BrSi |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | butyl(dimethyl)silane;hydrobromide |
| SMILES | Br.CCCC[SiH](C)C |
| InChI | InChI=1S/C6H16Si.BrH/c1-4-5-6-7(2)3;/h7H,4-6H2,1-3H3;1H |
| InChIKey | NDILBDQRCHFHDR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butyl(dimethyl)silane;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl(dimethyl)silane;hydrobromide?
The IUPAC name of butyl(dimethyl)silane;hydrobromide (CID 172772442) is butyl(dimethyl)silane;hydrobromide.
What is the SMILES notation for butyl(dimethyl)silane;hydrobromide?
The canonical SMILES for butyl(dimethyl)silane;hydrobromide is Br.CCCC[SiH](C)C.
What is the InChIKey of butyl(dimethyl)silane;hydrobromide?
The InChIKey is NDILBDQRCHFHDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16Si.BrH/c1-4-5-6-7(2)3;/h7H,4-6H2,1-3H3;1H.
What are the key properties of butyl(dimethyl)silane;hydrobromide?
butyl(dimethyl)silane;hydrobromide has a molecular weight of 197.19 g/mol, XLogP of 2.85, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butyl(dimethyl)silane;hydrobromide is sourced from PubChem (CID 172772442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).