About chlorosilane;decyl(dimethyl)silane;methane
chlorosilane;decyl(dimethyl)silane;methane (PubChem CID 174945657) has the molecular formula C13H35ClSi2
and a molecular weight of 283.05 g/mol. Its IUPAC name is chlorosilane;decyl(dimethyl)silane;methane.
Molecular Properties
| Compound Name | chlorosilane;decyl(dimethyl)silane;methane |
| PubChem CID | 174945657 |
| Molecular Formula | C13H35ClSi2 |
| Molecular Weight | 283.05 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | chlorosilane;decyl(dimethyl)silane;methane |
| SMILES | C.CCCCCCCCCC[SiH](C)C.[SiH3]Cl |
| InChI | InChI=1S/C12H28Si.CH4.ClH3Si/c1-4-5-6-7-8-9-10-11-12-13(2)3;;1-2/h13H,4-12H2,1-3H3;1H4;2H3 |
| InChIKey | PMCLQROYSQTMAD-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.05 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze chlorosilane;decyl(dimethyl)silane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorosilane;decyl(dimethyl)silane;methane?
The IUPAC name of chlorosilane;decyl(dimethyl)silane;methane (CID 174945657) is chlorosilane;decyl(dimethyl)silane;methane.
What is the SMILES notation for chlorosilane;decyl(dimethyl)silane;methane?
The canonical SMILES for chlorosilane;decyl(dimethyl)silane;methane is C.CCCCCCCCCC[SiH](C)C.[SiH3]Cl.
What is the InChIKey of chlorosilane;decyl(dimethyl)silane;methane?
The InChIKey is PMCLQROYSQTMAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28Si.CH4.ClH3Si/c1-4-5-6-7-8-9-10-11-12-13(2)3;;1-2/h13H,4-12H2,1-3H3;1H4;2H3.
What are the key properties of chlorosilane;decyl(dimethyl)silane;methane?
chlorosilane;decyl(dimethyl)silane;methane has a molecular weight of 283.05 g/mol, XLogP of 4.76, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chlorosilane;decyl(dimethyl)silane;methane is sourced from PubChem (CID 174945657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).