About sodium;dodecanoate;triethylsilane
sodium;dodecanoate;triethylsilane (PubChem CID 174445108) has the molecular formula C18H39NaO2Si
and a molecular weight of 338.58 g/mol. Its IUPAC name is sodium;dodecanoate;triethylsilane.
Molecular Properties
| Compound Name | sodium;dodecanoate;triethylsilane |
| PubChem CID | 174445108 |
| Molecular Formula | C18H39NaO2Si |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | sodium;dodecanoate;triethylsilane |
| SMILES | CCCCCCCCCCCC(=O)[O-].CC[SiH](CC)CC.[Na+] |
| InChI | InChI=1S/C12H24O2.C6H16Si.Na/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;1-4-7(5-2)6-3;/h2-11H2,1H3,(H,13,14);7H,4-6H2,1-3H3;/q;;+1/p-1 |
| InChIKey | DKLINWPXPPUMFC-UHFFFAOYSA-M |
| XLogP | 1.93 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sodium;dodecanoate;triethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;dodecanoate;triethylsilane?
The IUPAC name of sodium;dodecanoate;triethylsilane (CID 174445108) is sodium;dodecanoate;triethylsilane.
What is the SMILES notation for sodium;dodecanoate;triethylsilane?
The canonical SMILES for sodium;dodecanoate;triethylsilane is CCCCCCCCCCCC(=O)[O-].CC[SiH](CC)CC.[Na+].
What is the InChIKey of sodium;dodecanoate;triethylsilane?
The InChIKey is DKLINWPXPPUMFC-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H24O2.C6H16Si.Na/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;1-4-7(5-2)6-3;/h2-11H2,1H3,(H,13,14);7H,4-6H2,1-3H3;/q;;+1/p-1.
What are the key properties of sodium;dodecanoate;triethylsilane?
sodium;dodecanoate;triethylsilane has a molecular weight of 338.58 g/mol, XLogP of 1.93, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;dodecanoate;triethylsilane is sourced from PubChem (CID 174445108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).