C10H22Si — CID 175344299
buta-1,3-diene;triethylsilane (PubChem CID 175344299) has the molecular formula C10H22Si and a molecular weight of 170.37 g/mol. Its IUPAC name is buta-1,3-diene;triethylsilane.
| Compound Name | buta-1,3-diene;triethylsilane |
|---|---|
| PubChem CID | 175344299 |
| Molecular Formula | C10H22Si |
| Molecular Weight | 170.37 g/mol |
| Exact Mass | 170.15 |
| IUPAC Name | buta-1,3-diene;triethylsilane |
| SMILES | C=CC=C.CC[SiH](CC)CC |
| InChI | InChI=1S/C6H16Si.C4H6/c1-4-7(5-2)6-3;1-3-4-2/h7H,4-6H2,1-3H3;3-4H,1-2H2 |
| InChIKey | LWKQFMPDSCGCIF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|