C8H16O3P+ — CID 88766369
buta-1,3-diene;diethoxy(oxo)phosphanium (PubChem CID 88766369) has the molecular formula C8H16O3P+ and a molecular weight of 191.19 g/mol. Its IUPAC name is buta-1,3-diene;diethoxy(oxo)phosphanium.
| Compound Name | buta-1,3-diene;diethoxy(oxo)phosphanium |
|---|---|
| PubChem CID | 88766369 |
| Molecular Formula | C8H16O3P+ |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | buta-1,3-diene;diethoxy(oxo)phosphanium |
| SMILES | C=CC=C.CCO[P+](=O)OCC |
| InChI | InChI=1S/C4H10O3P.C4H6/c1-3-6-8(5)7-4-2;1-3-4-2/h3-4H2,1-2H3;3-4H,1-2H2/q+1; |
| InChIKey | LHFLGPLEXYJHKK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|