About bis(N,N-dimethylmethanamine);ethoxy-[6-[ethoxy(oxo)phosphaniumyl]oxyhexoxy]-oxophosphanium
bis(N,N-dimethylmethanamine);ethoxy-[6-[ethoxy(oxo)phosphaniumyl]oxyhexoxy]-oxophosphanium (PubChem CID 87949359) has the molecular formula C16H40N2O6P2+2
and a molecular weight of 418.45 g/mol. Its IUPAC name is bis(N,N-dimethylmethanamine);ethoxy-[6-[ethoxy(oxo)phosphaniumyl]oxyhexoxy]-oxophosphanium.
Molecular Properties
| Compound Name | bis(N,N-dimethylmethanamine);ethoxy-[6-[ethoxy(oxo)phosphaniumyl]oxyhexoxy]-oxophosphanium |
| PubChem CID | 87949359 |
| Molecular Formula | C16H40N2O6P2+2 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | bis(N,N-dimethylmethanamine);ethoxy-[6-[ethoxy(oxo)phosphaniumyl]oxyhexoxy]-oxophosphanium |
| SMILES | CCO[P+](=O)OCCCCCCO[P+](=O)OCC.CN(C)C.CN(C)C |
| InChI | InChI=1S/C10H22O6P2.2C3H9N/c1-3-13-17(11)15-9-7-5-6-8-10-16-18(12)14-4-2;2*1-4(2)3/h3-10H2,1-2H3;2*1-3H3/q+2;; |
| InChIKey | YEQHFYQKBMFRRH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(N,N-dimethylmethanamine);ethoxy-[6-[ethoxy(oxo)phosphaniumyl]oxyhexoxy]-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(N,N-dimethylmethanamine);ethoxy-[6-[ethoxy(oxo)phosphaniumyl]oxyhexoxy]-oxophosphanium?
The IUPAC name of bis(N,N-dimethylmethanamine);ethoxy-[6-[ethoxy(oxo)phosphaniumyl]oxyhexoxy]-oxophosphanium (CID 87949359) is bis(N,N-dimethylmethanamine);ethoxy-[6-[ethoxy(oxo)phosphaniumyl]oxyhexoxy]-oxophosphanium.
What is the SMILES notation for bis(N,N-dimethylmethanamine);ethoxy-[6-[ethoxy(oxo)phosphaniumyl]oxyhexoxy]-oxophosphanium?
The canonical SMILES for bis(N,N-dimethylmethanamine);ethoxy-[6-[ethoxy(oxo)phosphaniumyl]oxyhexoxy]-oxophosphanium is CCO[P+](=O)OCCCCCCO[P+](=O)OCC.CN(C)C.CN(C)C.
What is the InChIKey of bis(N,N-dimethylmethanamine);ethoxy-[6-[ethoxy(oxo)phosphaniumyl]oxyhexoxy]-oxophosphanium?
The InChIKey is YEQHFYQKBMFRRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O6P2.2C3H9N/c1-3-13-17(11)15-9-7-5-6-8-10-16-18(12)14-4-2;2*1-4(2)3/h3-10H2,1-2H3;2*1-3H3/q+2;;.
What are the key properties of bis(N,N-dimethylmethanamine);ethoxy-[6-[ethoxy(oxo)phosphaniumyl]oxyhexoxy]-oxophosphanium?
bis(N,N-dimethylmethanamine);ethoxy-[6-[ethoxy(oxo)phosphaniumyl]oxyhexoxy]-oxophosphanium has a molecular weight of 418.45 g/mol, XLogP of 4.32, 13 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(N,N-dimethylmethanamine);ethoxy-[6-[ethoxy(oxo)phosphaniumyl]oxyhexoxy]-oxophosphanium is sourced from PubChem (CID 87949359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).