About benzene;dihexoxy(oxo)phosphanium
benzene;dihexoxy(oxo)phosphanium (PubChem CID 19391965) has the molecular formula C18H32O3P+
and a molecular weight of 327.42 g/mol. Its IUPAC name is benzene;dihexoxy(oxo)phosphanium.
Molecular Properties
| Compound Name | benzene;dihexoxy(oxo)phosphanium |
| PubChem CID | 19391965 |
| Molecular Formula | C18H32O3P+ |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | benzene;dihexoxy(oxo)phosphanium |
| SMILES | CCCCCCO[P+](=O)OCCCCCC.c1ccccc1 |
| InChI | InChI=1S/C12H26O3P.C6H6/c1-3-5-7-9-11-14-16(13)15-12-10-8-6-4-2;1-2-4-6-5-3-1/h3-12H2,1-2H3;1-6H/q+1; |
| InChIKey | AVVLKIXXNAGDIO-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzene;dihexoxy(oxo)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;dihexoxy(oxo)phosphanium?
The IUPAC name of benzene;dihexoxy(oxo)phosphanium (CID 19391965) is benzene;dihexoxy(oxo)phosphanium.
What is the SMILES notation for benzene;dihexoxy(oxo)phosphanium?
The canonical SMILES for benzene;dihexoxy(oxo)phosphanium is CCCCCCO[P+](=O)OCCCCCC.c1ccccc1.
What is the InChIKey of benzene;dihexoxy(oxo)phosphanium?
The InChIKey is AVVLKIXXNAGDIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O3P.C6H6/c1-3-5-7-9-11-14-16(13)15-12-10-8-6-4-2;1-2-4-6-5-3-1/h3-12H2,1-2H3;1-6H/q+1;.
What are the key properties of benzene;dihexoxy(oxo)phosphanium?
benzene;dihexoxy(oxo)phosphanium has a molecular weight of 327.42 g/mol, XLogP of 6.52, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;dihexoxy(oxo)phosphanium is sourced from PubChem (CID 19391965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).