About dioctoxy(oxo)phosphanium;zinc
dioctoxy(oxo)phosphanium;zinc (PubChem CID 175522796) has the molecular formula C16H34O3PZn+
and a molecular weight of 370.81 g/mol. Its IUPAC name is dioctoxy(oxo)phosphanium;zinc.
Molecular Properties
| Compound Name | dioctoxy(oxo)phosphanium;zinc |
| PubChem CID | 175522796 |
| Molecular Formula | C16H34O3PZn+ |
| Molecular Weight | 370.81 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | dioctoxy(oxo)phosphanium;zinc |
| SMILES | CCCCCCCCO[P+](=O)OCCCCCCCC.[Zn] |
| InChI | InChI=1S/C16H34O3P.Zn/c1-3-5-7-9-11-13-15-18-20(17)19-16-14-12-10-8-6-4-2;/h3-16H2,1-2H3;/q+1; |
| InChIKey | QCCKEFLWBYEBCI-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.81 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dioctoxy(oxo)phosphanium;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioctoxy(oxo)phosphanium;zinc?
The IUPAC name of dioctoxy(oxo)phosphanium;zinc (CID 175522796) is dioctoxy(oxo)phosphanium;zinc.
What is the SMILES notation for dioctoxy(oxo)phosphanium;zinc?
The canonical SMILES for dioctoxy(oxo)phosphanium;zinc is CCCCCCCCO[P+](=O)OCCCCCCCC.[Zn].
What is the InChIKey of dioctoxy(oxo)phosphanium;zinc?
The InChIKey is QCCKEFLWBYEBCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O3P.Zn/c1-3-5-7-9-11-13-15-18-20(17)19-16-14-12-10-8-6-4-2;/h3-16H2,1-2H3;/q+1;.
What are the key properties of dioctoxy(oxo)phosphanium;zinc?
dioctoxy(oxo)phosphanium;zinc has a molecular weight of 370.81 g/mol, XLogP of 6.40, 16 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dioctoxy(oxo)phosphanium;zinc is sourced from PubChem (CID 175522796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).