About sodium;diethoxy(oxo)phosphanium;hydride
sodium;diethoxy(oxo)phosphanium;hydride (PubChem CID 173097047) has the molecular formula C4H11NaO3P+
and a molecular weight of 161.09 g/mol. Its IUPAC name is sodium;diethoxy(oxo)phosphanium;hydride.
Molecular Properties
| Compound Name | sodium;diethoxy(oxo)phosphanium;hydride |
| PubChem CID | 173097047 |
| Molecular Formula | C4H11NaO3P+ |
| Molecular Weight | 161.09 g/mol |
| Exact Mass | 161.03 |
| IUPAC Name | sodium;diethoxy(oxo)phosphanium;hydride |
| SMILES | CCO[P+](=O)OCC.[H-].[Na+] |
| InChI | InChI=1S/C4H10O3P.Na.H/c1-3-6-8(5)7-4-2;;/h3-4H2,1-2H3;;/q2*+1;-1 |
| InChIKey | KNOJLRMVTLBWRF-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.09 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;diethoxy(oxo)phosphanium;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;diethoxy(oxo)phosphanium;hydride?
The IUPAC name of sodium;diethoxy(oxo)phosphanium;hydride (CID 173097047) is sodium;diethoxy(oxo)phosphanium;hydride.
What is the SMILES notation for sodium;diethoxy(oxo)phosphanium;hydride?
The canonical SMILES for sodium;diethoxy(oxo)phosphanium;hydride is CCO[P+](=O)OCC.[H-].[Na+].
What is the InChIKey of sodium;diethoxy(oxo)phosphanium;hydride?
The InChIKey is KNOJLRMVTLBWRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O3P.Na.H/c1-3-6-8(5)7-4-2;;/h3-4H2,1-2H3;;/q2*+1;-1.
What are the key properties of sodium;diethoxy(oxo)phosphanium;hydride?
sodium;diethoxy(oxo)phosphanium;hydride has a molecular weight of 161.09 g/mol, XLogP of -1.17, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;diethoxy(oxo)phosphanium;hydride is sourced from PubChem (CID 173097047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).