About ethyl-bis(prop-2-enyl)silane;hydrofluoride
ethyl-bis(prop-2-enyl)silane;hydrofluoride (PubChem CID 174699217) has the molecular formula C8H17FSi
and a molecular weight of 160.31 g/mol. Its IUPAC name is ethyl-bis(prop-2-enyl)silane;hydrofluoride.
Molecular Properties
| Compound Name | ethyl-bis(prop-2-enyl)silane;hydrofluoride |
| PubChem CID | 174699217 |
| Molecular Formula | C8H17FSi |
| Molecular Weight | 160.31 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | ethyl-bis(prop-2-enyl)silane;hydrofluoride |
| SMILES | C=CC[SiH](CC)CC=C.F |
| InChI | InChI=1S/C8H16Si.FH/c1-4-7-9(6-3)8-5-2;/h4-5,9H,1-2,6-8H2,3H3;1H |
| InChIKey | KUQLMGQLQWJBKO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl-bis(prop-2-enyl)silane;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl-bis(prop-2-enyl)silane;hydrofluoride?
The IUPAC name of ethyl-bis(prop-2-enyl)silane;hydrofluoride (CID 174699217) is ethyl-bis(prop-2-enyl)silane;hydrofluoride.
What is the SMILES notation for ethyl-bis(prop-2-enyl)silane;hydrofluoride?
The canonical SMILES for ethyl-bis(prop-2-enyl)silane;hydrofluoride is C=CC[SiH](CC)CC=C.F.
What is the InChIKey of ethyl-bis(prop-2-enyl)silane;hydrofluoride?
The InChIKey is KUQLMGQLQWJBKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16Si.FH/c1-4-7-9(6-3)8-5-2;/h4-5,9H,1-2,6-8H2,3H3;1H.
What are the key properties of ethyl-bis(prop-2-enyl)silane;hydrofluoride?
ethyl-bis(prop-2-enyl)silane;hydrofluoride has a molecular weight of 160.31 g/mol, XLogP of 2.76, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl-bis(prop-2-enyl)silane;hydrofluoride is sourced from PubChem (CID 174699217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).