About diethyl(prop-2-enyl)silane;hydrochloride
diethyl(prop-2-enyl)silane;hydrochloride (PubChem CID 174892352) has the molecular formula C7H17ClSi
and a molecular weight of 164.75 g/mol. Its IUPAC name is diethyl(prop-2-enyl)silane;hydrochloride.
Molecular Properties
| Compound Name | diethyl(prop-2-enyl)silane;hydrochloride |
| PubChem CID | 174892352 |
| Molecular Formula | C7H17ClSi |
| Molecular Weight | 164.75 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | diethyl(prop-2-enyl)silane;hydrochloride |
| SMILES | C=CC[SiH](CC)CC.Cl |
| InChI | InChI=1S/C7H16Si.ClH/c1-4-7-8(5-2)6-3;/h4,8H,1,5-7H2,2-3H3;1H |
| InChIKey | UEYSLLRTZBQMDJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.75 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze diethyl(prop-2-enyl)silane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl(prop-2-enyl)silane;hydrochloride?
The IUPAC name of diethyl(prop-2-enyl)silane;hydrochloride (CID 174892352) is diethyl(prop-2-enyl)silane;hydrochloride.
What is the SMILES notation for diethyl(prop-2-enyl)silane;hydrochloride?
The canonical SMILES for diethyl(prop-2-enyl)silane;hydrochloride is C=CC[SiH](CC)CC.Cl.
What is the InChIKey of diethyl(prop-2-enyl)silane;hydrochloride?
The InChIKey is UEYSLLRTZBQMDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16Si.ClH/c1-4-7-8(5-2)6-3;/h4,8H,1,5-7H2,2-3H3;1H.
What are the key properties of diethyl(prop-2-enyl)silane;hydrochloride?
diethyl(prop-2-enyl)silane;hydrochloride has a molecular weight of 164.75 g/mol, XLogP of 2.86, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl(prop-2-enyl)silane;hydrochloride is sourced from PubChem (CID 174892352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).