About zinc;triethylsilane;dichloride
zinc;triethylsilane;dichloride (PubChem CID 160809278) has the molecular formula C6H16Cl2SiZn
and a molecular weight of 252.58 g/mol. Its IUPAC name is zinc;triethylsilane;dichloride.
Molecular Properties
| Compound Name | zinc;triethylsilane;dichloride |
| PubChem CID | 160809278 |
| Molecular Formula | C6H16Cl2SiZn |
| Molecular Weight | 252.58 g/mol |
| Exact Mass | 249.97 |
| IUPAC Name | zinc;triethylsilane;dichloride |
| SMILES | CC[SiH](CC)CC.[Cl-].[Cl-].[Zn+2] |
| InChI | InChI=1S/C6H16Si.2ClH.Zn/c1-4-7(5-2)6-3;;;/h7H,4-6H2,1-3H3;2*1H;/q;;;+2/p-2 |
| InChIKey | SECIDCRYPXBYHC-UHFFFAOYSA-L |
| XLogP | -3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.58 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;triethylsilane;dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;triethylsilane;dichloride?
The IUPAC name of zinc;triethylsilane;dichloride (CID 160809278) is zinc;triethylsilane;dichloride.
What is the SMILES notation for zinc;triethylsilane;dichloride?
The canonical SMILES for zinc;triethylsilane;dichloride is CC[SiH](CC)CC.[Cl-].[Cl-].[Zn+2].
What is the InChIKey of zinc;triethylsilane;dichloride?
The InChIKey is SECIDCRYPXBYHC-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H16Si.2ClH.Zn/c1-4-7(5-2)6-3;;;/h7H,4-6H2,1-3H3;2*1H;/q;;;+2/p-2.
What are the key properties of zinc;triethylsilane;dichloride?
zinc;triethylsilane;dichloride has a molecular weight of 252.58 g/mol, XLogP of -3.72, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;triethylsilane;dichloride is sourced from PubChem (CID 160809278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).