About magnesium;diethyl(methanidyl)silane;chloride
magnesium;diethyl(methanidyl)silane;chloride (PubChem CID 59538052) has the molecular formula C5H13ClMgSi
and a molecular weight of 161.00 g/mol. Its IUPAC name is magnesium;diethyl(methanidyl)silane;chloride.
Molecular Properties
| Compound Name | magnesium;diethyl(methanidyl)silane;chloride |
| PubChem CID | 59538052 |
| Molecular Formula | C5H13ClMgSi |
| Molecular Weight | 161.00 g/mol |
| Exact Mass | 160.03 |
| IUPAC Name | magnesium;diethyl(methanidyl)silane;chloride |
| SMILES | [CH2-][SiH](CC)CC.[Cl-].[Mg+2] |
| InChI | InChI=1S/C5H13Si.ClH.Mg/c1-4-6(3)5-2;;/h6H,3-5H2,1-2H3;1H;/q-1;;+2/p-1 |
| InChIKey | BIQKOGSPTPLZRV-UHFFFAOYSA-M |
| XLogP | -1.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.00 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze magnesium;diethyl(methanidyl)silane;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;diethyl(methanidyl)silane;chloride?
The IUPAC name of magnesium;diethyl(methanidyl)silane;chloride (CID 59538052) is magnesium;diethyl(methanidyl)silane;chloride.
What is the SMILES notation for magnesium;diethyl(methanidyl)silane;chloride?
The canonical SMILES for magnesium;diethyl(methanidyl)silane;chloride is [CH2-][SiH](CC)CC.[Cl-].[Mg+2].
What is the InChIKey of magnesium;diethyl(methanidyl)silane;chloride?
The InChIKey is BIQKOGSPTPLZRV-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H13Si.ClH.Mg/c1-4-6(3)5-2;;/h6H,3-5H2,1-2H3;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;diethyl(methanidyl)silane;chloride?
magnesium;diethyl(methanidyl)silane;chloride has a molecular weight of 161.00 g/mol, XLogP of -1.75, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;diethyl(methanidyl)silane;chloride is sourced from PubChem (CID 59538052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).