About lithium;azanide;trimethylsilane
lithium;azanide;trimethylsilane (PubChem CID 160704325) has the molecular formula C3H12LiNSi
and a molecular weight of 97.16 g/mol. Its IUPAC name is lithium;azanide;trimethylsilane.
Molecular Properties
| Compound Name | lithium;azanide;trimethylsilane |
| PubChem CID | 160704325 |
| Molecular Formula | C3H12LiNSi |
| Molecular Weight | 97.16 g/mol |
| Exact Mass | 97.09 |
| IUPAC Name | lithium;azanide;trimethylsilane |
| SMILES | C[SiH](C)C.[Li+].[NH2-] |
| InChI | InChI=1S/C3H10Si.Li.H2N/c1-4(2)3;;/h4H,1-3H3;;1H2/q;+1;-1 |
| InChIKey | RRAHSWZXABZFMO-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 33.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.16 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze lithium;azanide;trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;azanide;trimethylsilane?
The IUPAC name of lithium;azanide;trimethylsilane (CID 160704325) is lithium;azanide;trimethylsilane.
What is the SMILES notation for lithium;azanide;trimethylsilane?
The canonical SMILES for lithium;azanide;trimethylsilane is C[SiH](C)C.[Li+].[NH2-].
What is the InChIKey of lithium;azanide;trimethylsilane?
The InChIKey is RRAHSWZXABZFMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10Si.Li.H2N/c1-4(2)3;;/h4H,1-3H3;;1H2/q;+1;-1.
What are the key properties of lithium;azanide;trimethylsilane?
lithium;azanide;trimethylsilane has a molecular weight of 97.16 g/mol, XLogP of -1.18, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;azanide;trimethylsilane is sourced from PubChem (CID 160704325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).