About dihydroxy(oxo)phosphanium;bis(trimethylsilane)
dihydroxy(oxo)phosphanium;bis(trimethylsilane) (PubChem CID 173149913) has the molecular formula C6H22O3PSi2+
and a molecular weight of 229.38 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;bis(trimethylsilane).
Molecular Properties
| Compound Name | dihydroxy(oxo)phosphanium;bis(trimethylsilane) |
| PubChem CID | 173149913 |
| Molecular Formula | C6H22O3PSi2+ |
| Molecular Weight | 229.38 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | dihydroxy(oxo)phosphanium;bis(trimethylsilane) |
| SMILES | C[SiH](C)C.C[SiH](C)C.O=[P+](O)O |
| InChI | InChI=1S/2C3H10Si.HO3P/c3*1-4(2)3/h2*4H,1-3H3;(H-,1,2,3)/p+1 |
| InChIKey | RIDKKVFVMUAWSN-UHFFFAOYSA-O |
| XLogP | 1.83 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)phosphanium;bis(trimethylsilane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)phosphanium;bis(trimethylsilane)?
The IUPAC name of dihydroxy(oxo)phosphanium;bis(trimethylsilane) (CID 173149913) is dihydroxy(oxo)phosphanium;bis(trimethylsilane).
What is the SMILES notation for dihydroxy(oxo)phosphanium;bis(trimethylsilane)?
The canonical SMILES for dihydroxy(oxo)phosphanium;bis(trimethylsilane) is C[SiH](C)C.C[SiH](C)C.O=[P+](O)O.
What is the InChIKey of dihydroxy(oxo)phosphanium;bis(trimethylsilane)?
The InChIKey is RIDKKVFVMUAWSN-UHFFFAOYSA-O. The full InChI is InChI=1S/2C3H10Si.HO3P/c3*1-4(2)3/h2*4H,1-3H3;(H-,1,2,3)/p+1.
What are the key properties of dihydroxy(oxo)phosphanium;bis(trimethylsilane)?
dihydroxy(oxo)phosphanium;bis(trimethylsilane) has a molecular weight of 229.38 g/mol, XLogP of 1.83, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)phosphanium;bis(trimethylsilane) is sourced from PubChem (CID 173149913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).