About strontium;dihydroxy(oxo)phosphanium;hydron
strontium;dihydroxy(oxo)phosphanium;hydron (PubChem CID 173092966) has the molecular formula H3O3PSr+4
and a molecular weight of 169.62 g/mol. Its IUPAC name is strontium;dihydroxy(oxo)phosphanium;hydron.
Molecular Properties
| Compound Name | strontium;dihydroxy(oxo)phosphanium;hydron |
| PubChem CID | 173092966 |
| Molecular Formula | H3O3PSr+4 |
| Molecular Weight | 169.62 g/mol |
| Exact Mass | 169.89 |
| IUPAC Name | strontium;dihydroxy(oxo)phosphanium;hydron |
| SMILES | O=[P+](O)O.[H+].[Sr+2] |
| InChI | InChI=1S/HO3P.Sr/c1-4(2)3;/h(H-,1,2,3);/q;+2/p+2 |
| InChIKey | VHSBKZUMTRXSKO-UHFFFAOYSA-P |
| XLogP | -0.64 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.62 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze strontium;dihydroxy(oxo)phosphanium;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of strontium;dihydroxy(oxo)phosphanium;hydron?
The IUPAC name of strontium;dihydroxy(oxo)phosphanium;hydron (CID 173092966) is strontium;dihydroxy(oxo)phosphanium;hydron.
What is the SMILES notation for strontium;dihydroxy(oxo)phosphanium;hydron?
The canonical SMILES for strontium;dihydroxy(oxo)phosphanium;hydron is O=[P+](O)O.[H+].[Sr+2].
What is the InChIKey of strontium;dihydroxy(oxo)phosphanium;hydron?
The InChIKey is VHSBKZUMTRXSKO-UHFFFAOYSA-P. The full InChI is InChI=1S/HO3P.Sr/c1-4(2)3;/h(H-,1,2,3);/q;+2/p+2.
What are the key properties of strontium;dihydroxy(oxo)phosphanium;hydron?
strontium;dihydroxy(oxo)phosphanium;hydron has a molecular weight of 169.62 g/mol, XLogP of -0.64, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for strontium;dihydroxy(oxo)phosphanium;hydron is sourced from PubChem (CID 173092966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).