About dihydroxy(oxo)phosphanium;tungsten;hydrate
dihydroxy(oxo)phosphanium;tungsten;hydrate (PubChem CID 20688098) has the molecular formula H4O4PW+
and a molecular weight of 282.84 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;tungsten;hydrate.
Molecular Properties
| Compound Name | dihydroxy(oxo)phosphanium;tungsten;hydrate |
| PubChem CID | 20688098 |
| Molecular Formula | H4O4PW+ |
| Molecular Weight | 282.84 g/mol |
| Exact Mass | 282.94 |
| IUPAC Name | dihydroxy(oxo)phosphanium;tungsten;hydrate |
| SMILES | O.O=[P+](O)O.[W] |
| InChI | InChI=1S/HO3P.H2O.W/c1-4(2)3;;/h(H-,1,2,3);1H2;/p+1 |
| InChIKey | DCBGFGCQTZCDOV-UHFFFAOYSA-O |
| XLogP | -1.20 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.84 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)phosphanium;tungsten;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)phosphanium;tungsten;hydrate?
The IUPAC name of dihydroxy(oxo)phosphanium;tungsten;hydrate (CID 20688098) is dihydroxy(oxo)phosphanium;tungsten;hydrate.
What is the SMILES notation for dihydroxy(oxo)phosphanium;tungsten;hydrate?
The canonical SMILES for dihydroxy(oxo)phosphanium;tungsten;hydrate is O.O=[P+](O)O.[W].
What is the InChIKey of dihydroxy(oxo)phosphanium;tungsten;hydrate?
The InChIKey is DCBGFGCQTZCDOV-UHFFFAOYSA-O. The full InChI is InChI=1S/HO3P.H2O.W/c1-4(2)3;;/h(H-,1,2,3);1H2;/p+1.
What are the key properties of dihydroxy(oxo)phosphanium;tungsten;hydrate?
dihydroxy(oxo)phosphanium;tungsten;hydrate has a molecular weight of 282.84 g/mol, XLogP of -1.20, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)phosphanium;tungsten;hydrate is sourced from PubChem (CID 20688098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).