About CID 161252103
CID 161252103 (PubChem CID 161252103) has the molecular formula H2O3PSi+
and a molecular weight of 109.07 g/mol.
Molecular Properties
| Compound Name | CID 161252103 |
| PubChem CID | 161252103 |
| Molecular Formula | H2O3PSi+ |
| Molecular Weight | 109.07 g/mol |
| Exact Mass | 108.95 |
| IUPAC Name | — |
| SMILES | O=[P+](O)O.[Si] |
| InChI | InChI=1S/HO3P.Si/c1-4(2)3;/h(H-,1,2,3);/p+1 |
| InChIKey | FOEXMGSVPLWZKW-UHFFFAOYSA-O |
| XLogP | -0.75 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.07 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 161252103 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 161252103?
The IUPAC name of CID 161252103 (CID 161252103) is not available.
What is the SMILES notation for CID 161252103?
The canonical SMILES for CID 161252103 is O=[P+](O)O.[Si].
What is the InChIKey of CID 161252103?
The InChIKey is FOEXMGSVPLWZKW-UHFFFAOYSA-O. The full InChI is InChI=1S/HO3P.Si/c1-4(2)3;/h(H-,1,2,3);/p+1.
What are the key properties of CID 161252103?
CID 161252103 has a molecular weight of 109.07 g/mol, XLogP of -0.75, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 161252103 is sourced from PubChem (CID 161252103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).