About dihydroxy(oxo)phosphanium;samarium
dihydroxy(oxo)phosphanium;samarium (PubChem CID 161079463) has the molecular formula H2O3PSm+
and a molecular weight of 231.35 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;samarium.
Molecular Properties
| Compound Name | dihydroxy(oxo)phosphanium;samarium |
| PubChem CID | 161079463 |
| Molecular Formula | H2O3PSm+ |
| Molecular Weight | 231.35 g/mol |
| Exact Mass | 232.89 |
| IUPAC Name | dihydroxy(oxo)phosphanium;samarium |
| SMILES | O=[P+](O)O.[Sm] |
| InChI | InChI=1S/HO3P.Sm/c1-4(2)3;/h(H-,1,2,3);/p+1 |
| InChIKey | GVRRGYCIKRSERE-UHFFFAOYSA-O |
| XLogP | -0.37 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.35 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)phosphanium;samarium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)phosphanium;samarium?
The IUPAC name of dihydroxy(oxo)phosphanium;samarium (CID 161079463) is dihydroxy(oxo)phosphanium;samarium.
What is the SMILES notation for dihydroxy(oxo)phosphanium;samarium?
The canonical SMILES for dihydroxy(oxo)phosphanium;samarium is O=[P+](O)O.[Sm].
What is the InChIKey of dihydroxy(oxo)phosphanium;samarium?
The InChIKey is GVRRGYCIKRSERE-UHFFFAOYSA-O. The full InChI is InChI=1S/HO3P.Sm/c1-4(2)3;/h(H-,1,2,3);/p+1.
What are the key properties of dihydroxy(oxo)phosphanium;samarium?
dihydroxy(oxo)phosphanium;samarium has a molecular weight of 231.35 g/mol, XLogP of -0.37, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)phosphanium;samarium is sourced from PubChem (CID 161079463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).