About methylsilane;trimethylsilane
methylsilane;trimethylsilane (PubChem CID 175511940) has the molecular formula C4H16Si2
and a molecular weight of 120.34 g/mol. Its IUPAC name is methylsilane;trimethylsilane.
Molecular Properties
| Compound Name | methylsilane;trimethylsilane |
| PubChem CID | 175511940 |
| Molecular Formula | C4H16Si2 |
| Molecular Weight | 120.34 g/mol |
| Exact Mass | 120.08 |
| IUPAC Name | methylsilane;trimethylsilane |
| SMILES | C[SiH3].C[SiH](C)C |
| InChI | InChI=1S/C3H10Si.CH6Si/c1-4(2)3;1-2/h4H,1-3H3;1-2H3 |
| InChIKey | SDDBMNLZSSTHAR-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.34 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methylsilane;trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylsilane;trimethylsilane?
The IUPAC name of methylsilane;trimethylsilane (CID 175511940) is methylsilane;trimethylsilane.
What is the SMILES notation for methylsilane;trimethylsilane?
The canonical SMILES for methylsilane;trimethylsilane is C[SiH3].C[SiH](C)C.
What is the InChIKey of methylsilane;trimethylsilane?
The InChIKey is SDDBMNLZSSTHAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10Si.CH6Si/c1-4(2)3;1-2/h4H,1-3H3;1-2H3.
What are the key properties of methylsilane;trimethylsilane?
methylsilane;trimethylsilane has a molecular weight of 120.34 g/mol, XLogP of 0.50, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methylsilane;trimethylsilane is sourced from PubChem (CID 175511940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).