About dimethyl(silyloxy)silane;hydrochloride
dimethyl(silyloxy)silane;hydrochloride (PubChem CID 173295138) has the molecular formula C2H11ClOSi2
and a molecular weight of 142.73 g/mol. Its IUPAC name is dimethyl(silyloxy)silane;hydrochloride.
Molecular Properties
| Compound Name | dimethyl(silyloxy)silane;hydrochloride |
| PubChem CID | 173295138 |
| Molecular Formula | C2H11ClOSi2 |
| Molecular Weight | 142.73 g/mol |
| Exact Mass | 142.00 |
| IUPAC Name | dimethyl(silyloxy)silane;hydrochloride |
| SMILES | C[SiH](C)O[SiH3].Cl |
| InChI | InChI=1S/C2H10OSi2.ClH/c1-5(2)3-4;/h5H,1-2,4H3;1H |
| InChIKey | UDVXFXJDFSHAGT-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.73 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethyl(silyloxy)silane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl(silyloxy)silane;hydrochloride?
The IUPAC name of dimethyl(silyloxy)silane;hydrochloride (CID 173295138) is dimethyl(silyloxy)silane;hydrochloride.
What is the SMILES notation for dimethyl(silyloxy)silane;hydrochloride?
The canonical SMILES for dimethyl(silyloxy)silane;hydrochloride is C[SiH](C)O[SiH3].Cl.
What is the InChIKey of dimethyl(silyloxy)silane;hydrochloride?
The InChIKey is UDVXFXJDFSHAGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H10OSi2.ClH/c1-5(2)3-4;/h5H,1-2,4H3;1H.
What are the key properties of dimethyl(silyloxy)silane;hydrochloride?
dimethyl(silyloxy)silane;hydrochloride has a molecular weight of 142.73 g/mol, XLogP of -0.31, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl(silyloxy)silane;hydrochloride is sourced from PubChem (CID 173295138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).