About dimethyl(silyloxy)silane;oxirane;prop-2-enoic acid
dimethyl(silyloxy)silane;oxirane;prop-2-enoic acid (PubChem CID 173330109) has the molecular formula C7H18O4Si2
and a molecular weight of 222.39 g/mol. Its IUPAC name is dimethyl(silyloxy)silane;oxirane;prop-2-enoic acid.
Molecular Properties
| Compound Name | dimethyl(silyloxy)silane;oxirane;prop-2-enoic acid |
| PubChem CID | 173330109 |
| Molecular Formula | C7H18O4Si2 |
| Molecular Weight | 222.39 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | dimethyl(silyloxy)silane;oxirane;prop-2-enoic acid |
| SMILES | C1CO1.C=CC(=O)O.C[SiH](C)O[SiH3] |
| InChI | InChI=1S/C3H4O2.C2H10OSi2.C2H4O/c1-2-3(4)5;1-5(2)3-4;1-2-3-1/h2H,1H2,(H,4,5);5H,1-2,4H3;1-2H2 |
| InChIKey | GXEXJHLGQWXONE-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.39 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze dimethyl(silyloxy)silane;oxirane;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl(silyloxy)silane;oxirane;prop-2-enoic acid?
The IUPAC name of dimethyl(silyloxy)silane;oxirane;prop-2-enoic acid (CID 173330109) is dimethyl(silyloxy)silane;oxirane;prop-2-enoic acid.
What is the SMILES notation for dimethyl(silyloxy)silane;oxirane;prop-2-enoic acid?
The canonical SMILES for dimethyl(silyloxy)silane;oxirane;prop-2-enoic acid is C1CO1.C=CC(=O)O.C[SiH](C)O[SiH3].
What is the InChIKey of dimethyl(silyloxy)silane;oxirane;prop-2-enoic acid?
The InChIKey is GXEXJHLGQWXONE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O2.C2H10OSi2.C2H4O/c1-2-3(4)5;1-5(2)3-4;1-2-3-1/h2H,1H2,(H,4,5);5H,1-2,4H3;1-2H2.
What are the key properties of dimethyl(silyloxy)silane;oxirane;prop-2-enoic acid?
dimethyl(silyloxy)silane;oxirane;prop-2-enoic acid has a molecular weight of 222.39 g/mol, XLogP of -0.46, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl(silyloxy)silane;oxirane;prop-2-enoic acid is sourced from PubChem (CID 173330109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).