About methoxymethane;prop-2-enoic acid
methoxymethane;prop-2-enoic acid (PubChem CID 22665045) has the molecular formula C5H10O3
and a molecular weight of 118.13 g/mol. Its IUPAC name is methoxymethane;prop-2-enoic acid.
Molecular Properties
| Compound Name | methoxymethane;prop-2-enoic acid |
| PubChem CID | 22665045 |
| Molecular Formula | C5H10O3 |
| Molecular Weight | 118.13 g/mol |
| Exact Mass | 118.06 |
| IUPAC Name | methoxymethane;prop-2-enoic acid |
| SMILES | C=CC(=O)O.COC |
| InChI | InChI=1S/C3H4O2.C2H6O/c1-2-3(4)5;1-3-2/h2H,1H2,(H,4,5);1-2H3 |
| InChIKey | FCFDFAVHZMMDEO-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.13 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methoxymethane;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethane;prop-2-enoic acid?
The IUPAC name of methoxymethane;prop-2-enoic acid (CID 22665045) is methoxymethane;prop-2-enoic acid.
What is the SMILES notation for methoxymethane;prop-2-enoic acid?
The canonical SMILES for methoxymethane;prop-2-enoic acid is C=CC(=O)O.COC.
What is the InChIKey of methoxymethane;prop-2-enoic acid?
The InChIKey is FCFDFAVHZMMDEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O2.C2H6O/c1-2-3(4)5;1-3-2/h2H,1H2,(H,4,5);1-2H3.
What are the key properties of methoxymethane;prop-2-enoic acid?
methoxymethane;prop-2-enoic acid has a molecular weight of 118.13 g/mol, XLogP of 0.52, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethane;prop-2-enoic acid is sourced from PubChem (CID 22665045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).