C12H32O3Si6 — CID 173225657
dimethyl(silyloxy)silane;ethenyl-methyl-silyloxysilane;methyl-phenyl-silyloxysilane (PubChem CID 173225657) has the molecular formula C12H32O3Si6 and a molecular weight of 392.90 g/mol. Its IUPAC name is dimethyl(silyloxy)silane;ethenyl-methyl-silyloxysilane;methyl-phenyl-silyloxysilane.
| Compound Name | dimethyl(silyloxy)silane;ethenyl-methyl-silyloxysilane;methyl-phenyl-silyloxysilane |
|---|---|
| PubChem CID | 173225657 |
| Molecular Formula | C12H32O3Si6 |
| Molecular Weight | 392.90 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | dimethyl(silyloxy)silane;ethenyl-methyl-silyloxysilane;methyl-phenyl-silyloxysilane |
| SMILES | C=C[SiH](C)O[SiH3].C[SiH](C)O[SiH3].C[SiH](O[SiH3])c1ccccc1 |
| InChI | InChI=1S/C7H12OSi2.C3H10OSi2.C2H10OSi2/c1-10(8-9)7-5-3-2-4-6-7;1-3-6(2)4-5;1-5(2)3-4/h2-6,10H,1,9H3;3,6H,1H2,2,5H3;5H,1-2,4H3 |
| InChIKey | ATMLANPCXCYPFX-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.90 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|